C22H14ClNO8S — CID 6077753
2-chloro-4-[5-[(E)-[3-[(5-methoxycarbonylfuran-2-yl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 6077753) has the molecular formula C22H14ClNO8S and a molecular weight of 487.87 g/mol. Its IUPAC name is 2-chloro-4-[5-[(E)-[3-[(5-methoxycarbonylfuran-2-yl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-4-[5-[(E)-[3-[(5-methoxycarbonylfuran-2-yl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 6077753 |
| Molecular Formula | C22H14ClNO8S |
| Molecular Weight | 487.87 g/mol |
| Exact Mass | 487.01 |
| IUPAC Name | 2-chloro-4-[5-[(E)-[3-[(5-methoxycarbonylfuran-2-yl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | COC(=O)c1ccc(CN2C(=O)S/C(=C/c3ccc(-c4ccc(C(=O)O)c(Cl)c4)o3)C2=O)o1 |
| InChI | InChI=1S/C22H14ClNO8S/c1-30-21(28)17-7-4-13(32-17)10-24-19(25)18(33-22(24)29)9-12-3-6-16(31-12)11-2-5-14(20(26)27)15(23)8-11/h2-9H,10H2,1H3,(H,26,27)/b18-9+ |
| InChIKey | PGQFTCMVZWKUIT-GIJQJNRQSA-N |
| XLogP | 4.91 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.87 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|