C23H14Cl2N2O6S — CID 126244107
2-chloro-4-[5-[(E)-[3-[2-(2-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 126244107) has the molecular formula C23H14Cl2N2O6S and a molecular weight of 517.35 g/mol. Its IUPAC name is 2-chloro-4-[5-[(E)-[3-[2-(2-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-chloro-4-[5-[(E)-[3-[2-(2-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 126244107 |
| Molecular Formula | C23H14Cl2N2O6S |
| Molecular Weight | 517.35 g/mol |
| Exact Mass | 515.99 |
| IUPAC Name | 2-chloro-4-[5-[(E)-[3-[2-(2-chloroanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(-c3ccc(C(=O)O)c(Cl)c3)o2)C1=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C23H14Cl2N2O6S/c24-15-3-1-2-4-17(15)26-20(28)11-27-21(29)19(34-23(27)32)10-13-6-8-18(33-13)12-5-7-14(22(30)31)16(25)9-12/h1-10H,11H2,(H,26,28)(H,30,31)/b19-10+ |
| InChIKey | XXAOHBKQTUADCS-VXLYETTFSA-N |
| XLogP | 5.63 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.35 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|