C19H15Cl2NO4S3 — CID 3427303
2-[5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid (PubChem CID 3427303) has the molecular formula C19H15Cl2NO4S3 and a molecular weight of 488.44 g/mol. Its IUPAC name is 2-[5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 3427303 |
| Molecular Formula | C19H15Cl2NO4S3 |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 486.95 |
| IUPAC Name | 2-[5-[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(C(=O)O)N1C(=O)C(=Cc2ccc(-c3ccc(Cl)c(Cl)c3)o2)SC1=S |
| InChI | InChI=1S/C19H15Cl2NO4S3/c1-28-7-6-14(18(24)25)22-17(23)16(29-19(22)27)9-11-3-5-15(26-11)10-2-4-12(20)13(21)8-10/h2-5,8-9,14H,6-7H2,1H3,(H,24,25) |
| InChIKey | HSSJGOYABIOKSH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|