C20H15NO8S2 — CID 23474924
2-[(5Z)-5-[[5-(4-carboxyphenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid (PubChem CID 23474924) has the molecular formula C20H15NO8S2 and a molecular weight of 461.47 g/mol. Its IUPAC name is 2-[(5Z)-5-[[5-(4-carboxyphenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid.
| Compound Name | 2-[(5Z)-5-[[5-(4-carboxyphenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
|---|---|
| PubChem CID | 23474924 |
| Molecular Formula | C20H15NO8S2 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | 2-[(5Z)-5-[[5-(4-carboxyphenyl)furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
| SMILES | O=C(O)CCC(C(=O)O)N1C(=O)/C(=C/c2ccc(-c3ccc(C(=O)O)cc3)o2)SC1=S |
| InChI | InChI=1S/C20H15NO8S2/c22-16(23)8-6-13(19(27)28)21-17(24)15(31-20(21)30)9-12-5-7-14(29-12)10-1-3-11(4-2-10)18(25)26/h1-5,7,9,13H,6,8H2,(H,22,23)(H,25,26)(H,27,28)/b15-9- |
| InChIKey | SRGBQBHRCCVZFM-DHDCSXOGSA-N |
| XLogP | 3.16 |
| TPSA | 145.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|