C18H14N2O8S3 — CID 92948000
(2S)-2-[(5Z)-4-oxo-5-[[5-(4-sulfamoylphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid (PubChem CID 92948000) has the molecular formula C18H14N2O8S3 and a molecular weight of 482.52 g/mol. Its IUPAC name is (2S)-2-[(5Z)-4-oxo-5-[[5-(4-sulfamoylphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid.
| Compound Name | (2S)-2-[(5Z)-4-oxo-5-[[5-(4-sulfamoylphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid |
|---|---|
| PubChem CID | 92948000 |
| Molecular Formula | C18H14N2O8S3 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | (2S)-2-[(5Z)-4-oxo-5-[[5-(4-sulfamoylphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid |
| SMILES | NS(=O)(=O)c1ccc(-c2ccc(/C=C3\SC(=S)N([C@@H](CC(=O)O)C(=O)O)C3=O)o2)cc1 |
| InChI | InChI=1S/C18H14N2O8S3/c19-31(26,27)11-4-1-9(2-5-11)13-6-3-10(28-13)7-14-16(23)20(18(29)30-14)12(17(24)25)8-15(21)22/h1-7,12H,8H2,(H,21,22)(H,24,25)(H2,19,26,27)/b14-7-/t12-/m0/s1 |
| InChIKey | WEABFHOLFYHSCQ-OBTCNRAFSA-N |
| XLogP | 1.72 |
| TPSA | 168.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|