C13H10BrNO6S2 — CID 4762207
2-[5-[(5-bromofuran-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid (PubChem CID 4762207) has the molecular formula C13H10BrNO6S2 and a molecular weight of 420.26 g/mol. Its IUPAC name is 2-[5-[(5-bromofuran-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid.
| Compound Name | 2-[5-[(5-bromofuran-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
|---|---|
| PubChem CID | 4762207 |
| Molecular Formula | C13H10BrNO6S2 |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 418.91 |
| IUPAC Name | 2-[5-[(5-bromofuran-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
| SMILES | O=C(O)CCC(C(=O)O)N1C(=O)C(=Cc2ccc(Br)o2)SC1=S |
| InChI | InChI=1S/C13H10BrNO6S2/c14-9-3-1-6(21-9)5-8-11(18)15(13(22)23-8)7(12(19)20)2-4-10(16)17/h1,3,5,7H,2,4H2,(H,16,17)(H,19,20) |
| InChIKey | ZFRTXQDLIHHPAF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|