C16H13NO7S2 — CID 34886500
(2R)-2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid (PubChem CID 34886500) has the molecular formula C16H13NO7S2 and a molecular weight of 395.41 g/mol. Its IUPAC name is (2R)-2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid.
| Compound Name | (2R)-2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
|---|---|
| PubChem CID | 34886500 |
| Molecular Formula | C16H13NO7S2 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | (2R)-2-[(5E)-5-(1,3-benzodioxol-5-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](C(=O)O)N1C(=O)/C(=C\c2ccc3c(c2)OCO3)SC1=S |
| InChI | InChI=1S/C16H13NO7S2/c18-13(19)4-2-9(15(21)22)17-14(20)12(26-16(17)25)6-8-1-3-10-11(5-8)24-7-23-10/h1,3,5-6,9H,2,4,7H2,(H,18,19)(H,21,22)/b12-6+/t9-/m1/s1 |
| InChIKey | RMPNFABPBUPUBA-TZZQWBKVSA-N |
| XLogP | 1.93 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|