C17H15NO8S2 — CID 43861365
2-[(5Z)-5-[[3-(carboxymethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid (PubChem CID 43861365) has the molecular formula C17H15NO8S2 and a molecular weight of 425.44 g/mol. Its IUPAC name is 2-[(5Z)-5-[[3-(carboxymethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid.
| Compound Name | 2-[(5Z)-5-[[3-(carboxymethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
|---|---|
| PubChem CID | 43861365 |
| Molecular Formula | C17H15NO8S2 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.02 |
| IUPAC Name | 2-[(5Z)-5-[[3-(carboxymethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
| SMILES | O=C(O)CCC(C(=O)O)N1C(=O)/C(=C/c2cccc(OCC(=O)O)c2)SC1=S |
| InChI | InChI=1S/C17H15NO8S2/c19-13(20)5-4-11(16(24)25)18-15(23)12(28-17(18)27)7-9-2-1-3-10(6-9)26-8-14(21)22/h1-3,6-7,11H,4-5,8H2,(H,19,20)(H,21,22)(H,24,25)/b12-7- |
| InChIKey | YBUNVQPMMGUACB-GHXNOFRVSA-N |
| XLogP | 1.67 |
| TPSA | 141.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|