C17H17NO6S3 — CID 43861323
2-[(5Z)-5-[[3-(carboxymethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid (PubChem CID 43861323) has the molecular formula C17H17NO6S3 and a molecular weight of 427.53 g/mol. Its IUPAC name is 2-[(5Z)-5-[[3-(carboxymethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(5Z)-5-[[3-(carboxymethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 43861323 |
| Molecular Formula | C17H17NO6S3 |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 2-[(5Z)-5-[[3-(carboxymethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(C(=O)O)N1C(=O)/C(=C/c2cccc(OCC(=O)O)c2)SC1=S |
| InChI | InChI=1S/C17H17NO6S3/c1-26-6-5-12(16(22)23)18-15(21)13(27-17(18)25)8-10-3-2-4-11(7-10)24-9-14(19)20/h2-4,7-8,12H,5-6,9H2,1H3,(H,19,20)(H,22,23)/b13-8- |
| InChIKey | BROHEUGSEYENNW-JYRVWZFOSA-N |
| XLogP | 2.56 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|