C16H15NO4S3 — CID 7657613
(2R)-2-[(5Z)-5-[(4-formylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid (PubChem CID 7657613) has the molecular formula C16H15NO4S3 and a molecular weight of 381.50 g/mol. Its IUPAC name is (2R)-2-[(5Z)-5-[(4-formylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(5Z)-5-[(4-formylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 7657613 |
| Molecular Formula | C16H15NO4S3 |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | (2R)-2-[(5Z)-5-[(4-formylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](C(=O)O)N1C(=O)/C(=C/c2ccc(C=O)cc2)SC1=S |
| InChI | InChI=1S/C16H15NO4S3/c1-23-7-6-12(15(20)21)17-14(19)13(24-16(17)22)8-10-2-4-11(9-18)5-3-10/h2-5,8-9,12H,6-7H2,1H3,(H,20,21)/b13-8-/t12-/m1/s1 |
| InChIKey | NDFVFVFUZNHAQC-YFBAIUBQSA-N |
| XLogP | 2.91 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|