C15H14N2O5S3 — CID 9337585
(2R)-4-methylsulfanyl-2-[(5E)-5-[(2-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 9337585) has the molecular formula C15H14N2O5S3 and a molecular weight of 398.49 g/mol. Its IUPAC name is (2R)-4-methylsulfanyl-2-[(5E)-5-[(2-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | (2R)-4-methylsulfanyl-2-[(5E)-5-[(2-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 9337585 |
| Molecular Formula | C15H14N2O5S3 |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | (2R)-4-methylsulfanyl-2-[(5E)-5-[(2-nitrophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | CSCC[C@H](C(=O)O)N1C(=O)/C(=C\c2ccccc2[N+](=O)[O-])SC1=S |
| InChI | InChI=1S/C15H14N2O5S3/c1-24-7-6-11(14(19)20)16-13(18)12(25-15(16)23)8-9-4-2-3-5-10(9)17(21)22/h2-5,8,11H,6-7H2,1H3,(H,19,20)/b12-8+/t11-/m1/s1 |
| InChIKey | CQRIMEVAKGKFGY-OYGDSYQHSA-N |
| XLogP | 3.00 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|