C17H18NO4S3- — CID 9153620
(2S)-2-[(5E)-5-[(2-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoate (PubChem CID 9153620) has the molecular formula C17H18NO4S3- and a molecular weight of 396.54 g/mol. Its IUPAC name is (2S)-2-[(5E)-5-[(2-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoate.
| Compound Name | (2S)-2-[(5E)-5-[(2-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 9153620 |
| Molecular Formula | C17H18NO4S3- |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | (2S)-2-[(5E)-5-[(2-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoate |
| SMILES | CCOc1ccccc1/C=C1/SC(=S)N([C@@H](CCSC)C(=O)[O-])C1=O |
| InChI | InChI=1S/C17H19NO4S3/c1-3-22-13-7-5-4-6-11(13)10-14-15(19)18(17(23)25-14)12(16(20)21)8-9-24-2/h4-7,10,12H,3,8-9H2,1-2H3,(H,20,21)/p-1/b14-10+/t12-/m0/s1 |
| InChIKey | VZSGNYLTXFJLFX-LQELWAHVSA-M |
| XLogP | 2.16 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|