C20H20N2O4S3 — CID 50739937
2-[(5Z)-5-[(8-ethoxyquinolin-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid (PubChem CID 50739937) has the molecular formula C20H20N2O4S3 and a molecular weight of 448.59 g/mol. Its IUPAC name is 2-[(5Z)-5-[(8-ethoxyquinolin-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(5Z)-5-[(8-ethoxyquinolin-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 50739937 |
| Molecular Formula | C20H20N2O4S3 |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 2-[(5Z)-5-[(8-ethoxyquinolin-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid |
| SMILES | CCOc1cccc2ccc(/C=C3\SC(=S)N(C(CCSC)C(=O)O)C3=O)nc12 |
| InChI | InChI=1S/C20H20N2O4S3/c1-3-26-15-6-4-5-12-7-8-13(21-17(12)15)11-16-18(23)22(20(27)29-16)14(19(24)25)9-10-28-2/h4-8,11,14H,3,9-10H2,1-2H3,(H,24,25)/b16-11- |
| InChIKey | HUNRZRPKVKMEOW-WJDWOHSUSA-N |
| XLogP | 4.04 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|