C18H13ClN2O5S2 — CID 71947122
2-[5-[(8-chloroquinolin-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid (PubChem CID 71947122) has the molecular formula C18H13ClN2O5S2 and a molecular weight of 436.90 g/mol. Its IUPAC name is 2-[5-[(8-chloroquinolin-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid.
| Compound Name | 2-[5-[(8-chloroquinolin-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
|---|---|
| PubChem CID | 71947122 |
| Molecular Formula | C18H13ClN2O5S2 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.00 |
| IUPAC Name | 2-[5-[(8-chloroquinolin-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
| SMILES | O=C(O)CCC(C(=O)O)N1C(=O)C(=Cc2ccc3cccc(Cl)c3n2)SC1=S |
| InChI | InChI=1S/C18H13ClN2O5S2/c19-11-3-1-2-9-4-5-10(20-15(9)11)8-13-16(24)21(18(27)28-13)12(17(25)26)6-7-14(22)23/h1-5,8,12H,6-7H2,(H,22,23)(H,25,26) |
| InChIKey | ACPBFURBTDCBJT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|