C17H12N2O5S2 — CID 4898160
2-[4-oxo-5-(quinolin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid (PubChem CID 4898160) has the molecular formula C17H12N2O5S2 and a molecular weight of 388.43 g/mol. Its IUPAC name is 2-[4-oxo-5-(quinolin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid.
| Compound Name | 2-[4-oxo-5-(quinolin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid |
|---|---|
| PubChem CID | 4898160 |
| Molecular Formula | C17H12N2O5S2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 2-[4-oxo-5-(quinolin-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)N1C(=O)C(=Cc2ccc3ccccc3n2)SC1=S |
| InChI | InChI=1S/C17H12N2O5S2/c20-14(21)8-12(16(23)24)19-15(22)13(26-17(19)25)7-10-6-5-9-3-1-2-4-11(9)18-10/h1-7,12H,8H2,(H,20,21)(H,23,24) |
| InChIKey | IHKWWVWOIKDBFC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|