C12H9NO5S3 — CID 2027436
(2R)-2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanedioic acid (PubChem CID 2027436) has the molecular formula C12H9NO5S3 and a molecular weight of 343.41 g/mol. Its IUPAC name is (2R)-2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanedioic acid.
| Compound Name | (2R)-2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanedioic acid |
|---|---|
| PubChem CID | 2027436 |
| Molecular Formula | C12H9NO5S3 |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 342.96 |
| IUPAC Name | (2R)-2-[(5E)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]butanedioic acid |
| SMILES | O=C(O)C[C@H](C(=O)O)N1C(=O)/C(=C\c2cccs2)SC1=S |
| InChI | InChI=1S/C12H9NO5S3/c14-9(15)5-7(11(17)18)13-10(16)8(21-12(13)19)4-6-2-1-3-20-6/h1-4,7H,5H2,(H,14,15)(H,17,18)/b8-4+/t7-/m1/s1 |
| InChIKey | SHXVXJRIDDKZLK-VKDKVYATSA-N |
| XLogP | 1.88 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|