C13H12N2O5S2 — CID 7562703
(2S)-2-[(5Z)-5-[(1-methylpyrrol-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid (PubChem CID 7562703) has the molecular formula C13H12N2O5S2 and a molecular weight of 340.38 g/mol. Its IUPAC name is (2S)-2-[(5Z)-5-[(1-methylpyrrol-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid.
| Compound Name | (2S)-2-[(5Z)-5-[(1-methylpyrrol-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid |
|---|---|
| PubChem CID | 7562703 |
| Molecular Formula | C13H12N2O5S2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | (2S)-2-[(5Z)-5-[(1-methylpyrrol-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid |
| SMILES | Cn1cccc1/C=C1\SC(=S)N([C@@H](CC(=O)O)C(=O)O)C1=O |
| InChI | InChI=1S/C13H12N2O5S2/c1-14-4-2-3-7(14)5-9-11(18)15(13(21)22-9)8(12(19)20)6-10(16)17/h2-5,8H,6H2,1H3,(H,16,17)(H,19,20)/b9-5-/t8-/m0/s1 |
| InChIKey | ATTLQCXMUVMLOD-HXOPTJOXSA-N |
| XLogP | 1.15 |
| TPSA | 99.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|