C14H12N2O5S2-2 — CID 2024728
(2R)-2-[(5Z)-5-[(1-methylpyrrol-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioate (PubChem CID 2024728) has the molecular formula C14H12N2O5S2-2 and a molecular weight of 352.39 g/mol. Its IUPAC name is (2R)-2-[(5Z)-5-[(1-methylpyrrol-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioate.
| Compound Name | (2R)-2-[(5Z)-5-[(1-methylpyrrol-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioate |
|---|---|
| PubChem CID | 2024728 |
| Molecular Formula | C14H12N2O5S2-2 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | (2R)-2-[(5Z)-5-[(1-methylpyrrol-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioate |
| SMILES | Cn1cccc1/C=C1\SC(=S)N([C@H](CCC(=O)[O-])C(=O)[O-])C1=O |
| InChI | InChI=1S/C14H14N2O5S2/c1-15-6-2-3-8(15)7-10-12(19)16(14(22)23-10)9(13(20)21)4-5-11(17)18/h2-3,6-7,9H,4-5H2,1H3,(H,17,18)(H,20,21)/p-2/b10-7-/t9-/m1/s1 |
| InChIKey | GXXDZFIPOWKWKL-SBMLRHLQSA-L |
| XLogP | -1.13 |
| TPSA | 105.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|