C12H11N2O4S2- — CID 7656637
(2S)-3-hydroxy-2-[(5E)-5-[(1-methylpyrrol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate (PubChem CID 7656637) has the molecular formula C12H11N2O4S2- and a molecular weight of 311.36 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[(5E)-5-[(1-methylpyrrol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | (2S)-3-hydroxy-2-[(5E)-5-[(1-methylpyrrol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 7656637 |
| Molecular Formula | C12H11N2O4S2- |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | (2S)-3-hydroxy-2-[(5E)-5-[(1-methylpyrrol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
| SMILES | Cn1ccc(/C=C2/SC(=S)N([C@@H](CO)C(=O)[O-])C2=O)c1 |
| InChI | InChI=1S/C12H12N2O4S2/c1-13-3-2-7(5-13)4-9-10(16)14(12(19)20-9)8(6-15)11(17)18/h2-5,8,15H,6H2,1H3,(H,17,18)/p-1/b9-4+/t8-/m0/s1 |
| InChIKey | FLHKRSAOGAXLKE-DHFUWRPHSA-M |
| XLogP | -0.66 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|