C13H13N2O3S2- — CID 7656580
4-[(5E)-5-[(1-methylpyrrol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate (PubChem CID 7656580) has the molecular formula C13H13N2O3S2- and a molecular weight of 309.39 g/mol. Its IUPAC name is 4-[(5E)-5-[(1-methylpyrrol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | 4-[(5E)-5-[(1-methylpyrrol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 7656580 |
| Molecular Formula | C13H13N2O3S2- |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 4-[(5E)-5-[(1-methylpyrrol-3-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
| SMILES | Cn1ccc(/C=C2/SC(=S)N(CCCC(=O)[O-])C2=O)c1 |
| InChI | InChI=1S/C13H14N2O3S2/c1-14-6-4-9(8-14)7-10-12(18)15(13(19)20-10)5-2-3-11(16)17/h4,6-8H,2-3,5H2,1H3,(H,16,17)/p-1/b10-7+ |
| InChIKey | WRISBMJUDJLVLI-JXMROGBWSA-M |
| XLogP | 0.76 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|