C21H25N2O3S2- — CID 7912342
6-[(5E)-4-oxo-5-[(4-piperidin-1-ylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate (PubChem CID 7912342) has the molecular formula C21H25N2O3S2- and a molecular weight of 417.58 g/mol. Its IUPAC name is 6-[(5E)-4-oxo-5-[(4-piperidin-1-ylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate.
| Compound Name | 6-[(5E)-4-oxo-5-[(4-piperidin-1-ylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 7912342 |
| Molecular Formula | C21H25N2O3S2- |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 6-[(5E)-4-oxo-5-[(4-piperidin-1-ylphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
| SMILES | O=C([O-])CCCCCN1C(=O)/C(=C\c2ccc(N3CCCCC3)cc2)SC1=S |
| InChI | InChI=1S/C21H26N2O3S2/c24-19(25)7-3-1-6-14-23-20(26)18(28-21(23)27)15-16-8-10-17(11-9-16)22-12-4-2-5-13-22/h8-11,15H,1-7,12-14H2,(H,24,25)/p-1/b18-15+ |
| InChIKey | UWGPCRYRUOVWMY-OBGWFSINSA-M |
| XLogP | 3.19 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|