C13H9NO6S2-2 — CID 7206497
(2R)-2-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioate (PubChem CID 7206497) has the molecular formula C13H9NO6S2-2 and a molecular weight of 339.35 g/mol. Its IUPAC name is (2R)-2-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioate.
| Compound Name | (2R)-2-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioate |
|---|---|
| PubChem CID | 7206497 |
| Molecular Formula | C13H9NO6S2-2 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | (2R)-2-[(5E)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioate |
| SMILES | O=C([O-])CC[C@H](C(=O)[O-])N1C(=O)/C(=C\c2ccco2)SC1=S |
| InChI | InChI=1S/C13H11NO6S2/c15-10(16)4-3-8(12(18)19)14-11(17)9(22-13(14)21)6-7-2-1-5-20-7/h1-2,5-6,8H,3-4H2,(H,15,16)(H,18,19)/p-2/b9-6+/t8-/m1/s1 |
| InChIKey | PYTVVQHHLPUAGB-GTUWVTDSSA-L |
| XLogP | -0.87 |
| TPSA | 113.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|