C13H13NO4S2 — CID 43826320
2-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid (PubChem CID 43826320) has the molecular formula C13H13NO4S2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid.
| Compound Name | 2-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 43826320 |
| Molecular Formula | C13H13NO4S2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 2-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)N1C(=O)/C(=C/c2ccco2)SC1=S |
| InChI | InChI=1S/C13H13NO4S2/c1-2-4-9(12(16)17)14-11(15)10(20-13(14)19)7-8-5-3-6-18-8/h3,5-7,9H,2,4H2,1H3,(H,16,17)/b10-7- |
| InChIKey | PLTUXBNFODKTIE-YFHOEESVSA-N |
| XLogP | 2.73 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|