C14H13NO4S2 — CID 89165672
3-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanedial (PubChem CID 89165672) has the molecular formula C14H13NO4S2 and a molecular weight of 323.39 g/mol. Its IUPAC name is 3-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanedial.
| Compound Name | 3-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanedial |
|---|---|
| PubChem CID | 89165672 |
| Molecular Formula | C14H13NO4S2 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 3-[(5Z)-5-(furan-2-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanedial |
| SMILES | O=CCCC(CC=O)N1C(=O)/C(=C/c2ccco2)SC1=S |
| InChI | InChI=1S/C14H13NO4S2/c16-6-1-3-10(5-7-17)15-13(18)12(21-14(15)20)9-11-4-2-8-19-11/h2,4,6-10H,1,3,5H2/b12-9- |
| InChIKey | NYRYSAMHOGPEDV-XFXZXTDPSA-N |
| XLogP | 2.42 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|