C17H15NO6S2 — CID 40648575
(2R)-2-[(5E)-4-oxo-5-[(2-prop-2-enoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid (PubChem CID 40648575) has the molecular formula C17H15NO6S2 and a molecular weight of 393.44 g/mol. Its IUPAC name is (2R)-2-[(5E)-4-oxo-5-[(2-prop-2-enoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid.
| Compound Name | (2R)-2-[(5E)-4-oxo-5-[(2-prop-2-enoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid |
|---|---|
| PubChem CID | 40648575 |
| Molecular Formula | C17H15NO6S2 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | (2R)-2-[(5E)-4-oxo-5-[(2-prop-2-enoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanedioic acid |
| SMILES | C=CCOc1ccccc1/C=C1/SC(=S)N([C@H](CC(=O)O)C(=O)O)C1=O |
| InChI | InChI=1S/C17H15NO6S2/c1-2-7-24-12-6-4-3-5-10(12)8-13-15(21)18(17(25)26-13)11(16(22)23)9-14(19)20/h2-6,8,11H,1,7,9H2,(H,19,20)(H,22,23)/b13-8+/t11-/m1/s1 |
| InChIKey | MXASAHLXVYVTHA-KAQJVSAMSA-N |
| XLogP | 2.38 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|