C18H19NO6S2 — CID 43861548
2-[(5Z)-5-[[2-(carboxymethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid (PubChem CID 43861548) has the molecular formula C18H19NO6S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-[(5Z)-5-[[2-(carboxymethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid.
| Compound Name | 2-[(5Z)-5-[[2-(carboxymethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 43861548 |
| Molecular Formula | C18H19NO6S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 2-[(5Z)-5-[[2-(carboxymethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid |
| SMILES | CCC(C)C(C(=O)O)N1C(=O)/C(=C/c2ccccc2OCC(=O)O)SC1=S |
| InChI | InChI=1S/C18H19NO6S2/c1-3-10(2)15(17(23)24)19-16(22)13(27-18(19)26)8-11-6-4-5-7-12(11)25-9-14(20)21/h4-8,10,15H,3,9H2,1-2H3,(H,20,21)(H,23,24)/b13-8- |
| InChIKey | VEQWHZWPHIXXRX-JYRVWZFOSA-N |
| XLogP | 2.85 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|