C18H21NO5S2 — CID 7656347
(2S,3R)-2-[(5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid (PubChem CID 7656347) has the molecular formula C18H21NO5S2 and a molecular weight of 395.50 g/mol. Its IUPAC name is (2S,3R)-2-[(5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid.
| Compound Name | (2S,3R)-2-[(5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 7656347 |
| Molecular Formula | C18H21NO5S2 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | (2S,3R)-2-[(5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-methylpentanoic acid |
| SMILES | CC[C@@H](C)[C@@H](C(=O)O)N1C(=O)/C(=C/c2cccc(OC)c2OC)SC1=S |
| InChI | InChI=1S/C18H21NO5S2/c1-5-10(2)14(17(21)22)19-16(20)13(26-18(19)25)9-11-7-6-8-12(23-3)15(11)24-4/h6-10,14H,5H2,1-4H3,(H,21,22)/b13-9-/t10-,14+/m1/s1 |
| InChIKey | JKQCHIAYAZVAJN-OIQXIXSWSA-N |
| XLogP | 3.40 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|