C17H19NO5S3 — CID 6245818
2-[(5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid (PubChem CID 6245818) has the molecular formula C17H19NO5S3 and a molecular weight of 413.54 g/mol. Its IUPAC name is 2-[(5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 6245818 |
| Molecular Formula | C17H19NO5S3 |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 2-[(5Z)-5-[(2,3-dimethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid |
| SMILES | COc1cccc(/C=C2\SC(=S)N(C(CCSC)C(=O)O)C2=O)c1OC |
| InChI | InChI=1S/C17H19NO5S3/c1-22-12-6-4-5-10(14(12)23-2)9-13-15(19)18(17(24)26-13)11(16(20)21)7-8-25-3/h4-6,9,11H,7-8H2,1-3H3,(H,20,21)/b13-9- |
| InChIKey | UIPQQYKDHTVJKV-LCYFTJDESA-N |
| XLogP | 3.11 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|