C18H21NO6S3 — CID 3755696
4-methylsulfanyl-2-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 3755696) has the molecular formula C18H21NO6S3 and a molecular weight of 443.57 g/mol. Its IUPAC name is 4-methylsulfanyl-2-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-methylsulfanyl-2-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 3755696 |
| Molecular Formula | C18H21NO6S3 |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | 4-methylsulfanyl-2-[4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | COc1cc(C=C2SC(=S)N(C(CCSC)C(=O)O)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C18H21NO6S3/c1-23-12-7-10(8-13(24-2)15(12)25-3)9-14-16(20)19(18(26)28-14)11(17(21)22)5-6-27-4/h7-9,11H,5-6H2,1-4H3,(H,21,22) |
| InChIKey | TWGMELWOBSUZKQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|