C16H14ClNO7S2 — CID 44821262
2-[(5Z)-5-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid (PubChem CID 44821262) has the molecular formula C16H14ClNO7S2 and a molecular weight of 431.88 g/mol. Its IUPAC name is 2-[(5Z)-5-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid.
| Compound Name | 2-[(5Z)-5-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
|---|---|
| PubChem CID | 44821262 |
| Molecular Formula | C16H14ClNO7S2 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | 2-[(5Z)-5-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]pentanedioic acid |
| SMILES | COc1cc(/C=C2\SC(=S)N(C(CCC(=O)O)C(=O)O)C2=O)cc(Cl)c1O |
| InChI | InChI=1S/C16H14ClNO7S2/c1-25-10-5-7(4-8(17)13(10)21)6-11-14(22)18(16(26)27-11)9(15(23)24)2-3-12(19)20/h4-6,9,21H,2-3H2,1H3,(H,19,20)(H,23,24)/b11-6- |
| InChIKey | VFVMFDUPUUNMQL-WDZFZDKYSA-N |
| XLogP | 2.57 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|