C13H10ClNO6S — CID 7318692
2-[(5E)-5-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 7318692) has the molecular formula C13H10ClNO6S and a molecular weight of 343.74 g/mol. Its IUPAC name is 2-[(5E)-5-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 7318692 |
| Molecular Formula | C13H10ClNO6S |
| Molecular Weight | 343.74 g/mol |
| Exact Mass | 342.99 |
| IUPAC Name | 2-[(5E)-5-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)O)C2=O)cc(Cl)c1O |
| InChI | InChI=1S/C13H10ClNO6S/c1-21-8-3-6(2-7(14)11(8)18)4-9-12(19)15(5-10(16)17)13(20)22-9/h2-4,18H,5H2,1H3,(H,16,17)/b9-4+ |
| InChIKey | KLRZZCQRXXIARK-RUDMXATFSA-N |
| XLogP | 2.18 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.74 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|