C20H17ClN2O6S — CID 126222144
2-[(5Z)-5-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 126222144) has the molecular formula C20H17ClN2O6S and a molecular weight of 448.88 g/mol. Its IUPAC name is 2-[(5Z)-5-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126222144 |
| Molecular Formula | C20H17ClN2O6S |
| Molecular Weight | 448.88 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 2-[(5Z)-5-[(3-chloro-4-hydroxy-5-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN1C(=O)S/C(=C\c2cc(Cl)c(O)c(OC)c2)C1=O |
| InChI | InChI=1S/C20H17ClN2O6S/c1-28-14-6-4-3-5-13(14)22-17(24)10-23-19(26)16(30-20(23)27)9-11-7-12(21)18(25)15(8-11)29-2/h3-9,25H,10H2,1-2H3,(H,22,24)/b16-9- |
| InChIKey | GTDIJCDCROXVLK-SXGWCWSVSA-N |
| XLogP | 3.74 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.88 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|