C23H23IN2O6S — CID 126279402
2-[(5Z)-5-[(3-iodo-5-methoxy-4-propoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 126279402) has the molecular formula C23H23IN2O6S and a molecular weight of 582.42 g/mol. Its IUPAC name is 2-[(5Z)-5-[(3-iodo-5-methoxy-4-propoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(5Z)-5-[(3-iodo-5-methoxy-4-propoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126279402 |
| Molecular Formula | C23H23IN2O6S |
| Molecular Weight | 582.42 g/mol |
| Exact Mass | 582.03 |
| IUPAC Name | 2-[(5Z)-5-[(3-iodo-5-methoxy-4-propoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | CCCOc1c(I)cc(/C=C2\SC(=O)N(CC(=O)Nc3ccccc3OC)C2=O)cc1OC |
| InChI | InChI=1S/C23H23IN2O6S/c1-4-9-32-21-15(24)10-14(11-18(21)31-3)12-19-22(28)26(23(29)33-19)13-20(27)25-16-7-5-6-8-17(16)30-2/h5-8,10-12H,4,9,13H2,1-3H3,(H,25,27)/b19-12- |
| InChIKey | JHGCZBCSYYTQIA-UNOMPAQXSA-N |
| XLogP | 4.77 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|