C28H25IN2O5S — CID 126276875
N-(2,3-dimethylphenyl)-2-[(5E)-5-[(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 126276875) has the molecular formula C28H25IN2O5S and a molecular weight of 628.49 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[(5E)-5-[(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[(5E)-5-[(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 126276875 |
| Molecular Formula | C28H25IN2O5S |
| Molecular Weight | 628.49 g/mol |
| Exact Mass | 628.05 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[(5E)-5-[(3-iodo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)Nc3cccc(C)c3C)C2=O)cc(I)c1OCc1ccccc1 |
| InChI | InChI=1S/C28H25IN2O5S/c1-17-8-7-11-22(18(17)2)30-25(32)15-31-27(33)24(37-28(31)34)14-20-12-21(29)26(23(13-20)35-3)36-16-19-9-5-4-6-10-19/h4-14H,15-16H2,1-3H3,(H,30,32)/b24-14+ |
| InChIKey | HJPDWDGULHUYRH-ZVHZXABRSA-N |
| XLogP | 6.17 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.49 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|