C18H19NO6S3 — CID 43861324
2-[(5Z)-5-[[3-(1-carboxyethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid (PubChem CID 43861324) has the molecular formula C18H19NO6S3 and a molecular weight of 441.55 g/mol. Its IUPAC name is 2-[(5Z)-5-[[3-(1-carboxyethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[(5Z)-5-[[3-(1-carboxyethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 43861324 |
| Molecular Formula | C18H19NO6S3 |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 2-[(5Z)-5-[[3-(1-carboxyethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(C(=O)O)N1C(=O)/C(=C/c2cccc(OC(C)C(=O)O)c2)SC1=S |
| InChI | InChI=1S/C18H19NO6S3/c1-10(16(21)22)25-12-5-3-4-11(8-12)9-14-15(20)19(18(26)28-14)13(17(23)24)6-7-27-2/h3-5,8-10,13H,6-7H2,1-2H3,(H,21,22)(H,23,24)/b14-9- |
| InChIKey | KFGAMXKFQKTEBV-ZROIWOOFSA-N |
| XLogP | 2.95 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|