C16H16NO5S3- — CID 9337631
(2R)-2-[(5Z)-5-[(2-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoate (PubChem CID 9337631) has the molecular formula C16H16NO5S3- and a molecular weight of 398.51 g/mol. Its IUPAC name is (2R)-2-[(5Z)-5-[(2-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoate.
| Compound Name | (2R)-2-[(5Z)-5-[(2-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 9337631 |
| Molecular Formula | C16H16NO5S3- |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | (2R)-2-[(5Z)-5-[(2-hydroxy-3-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoate |
| SMILES | COc1cccc(/C=C2\SC(=S)N([C@H](CCSC)C(=O)[O-])C2=O)c1O |
| InChI | InChI=1S/C16H17NO5S3/c1-22-11-5-3-4-9(13(11)18)8-12-14(19)17(16(23)25-12)10(15(20)21)6-7-24-2/h3-5,8,10,18H,6-7H2,1-2H3,(H,20,21)/p-1/b12-8-/t10-/m1/s1 |
| InChIKey | YZJZRNOPGDKNDZ-BKLZJWBFSA-M |
| XLogP | 1.47 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|