C18H18NO3S3- — CID 9337608
(2S)-2-[(5E)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoate (PubChem CID 9337608) has the molecular formula C18H18NO3S3- and a molecular weight of 392.55 g/mol. Its IUPAC name is (2S)-2-[(5E)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoate.
| Compound Name | (2S)-2-[(5E)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 9337608 |
| Molecular Formula | C18H18NO3S3- |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | (2S)-2-[(5E)-5-[(E)-2-methyl-3-phenylprop-2-enylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](C(=O)[O-])N1C(=O)/C(=C\C(C)=C\c2ccccc2)SC1=S |
| InChI | InChI=1S/C18H19NO3S3/c1-12(10-13-6-4-3-5-7-13)11-15-16(20)19(18(23)25-15)14(17(21)22)8-9-24-2/h3-7,10-11,14H,8-9H2,1-2H3,(H,21,22)/p-1/b12-10+,15-11+/t14-/m0/s1 |
| InChIKey | SQXQQDPJICIETD-ZPDHENSJSA-M |
| XLogP | 2.71 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|