C18H21NO6S — CID 126247113
(2S)-2-[2-[(E)-[3-[(2R)-butan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]propanoic acid (PubChem CID 126247113) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is (2S)-2-[2-[(E)-[3-[(2R)-butan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]propanoic acid.
| Compound Name | (2S)-2-[2-[(E)-[3-[(2R)-butan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126247113 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | (2S)-2-[2-[(E)-[3-[(2R)-butan-2-yl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]propanoic acid |
| SMILES | CC[C@@H](C)N1C(=O)S/C(=C/c2cccc(OC)c2O[C@@H](C)C(=O)O)C1=O |
| InChI | InChI=1S/C18H21NO6S/c1-5-10(2)19-16(20)14(26-18(19)23)9-12-7-6-8-13(24-4)15(12)25-11(3)17(21)22/h6-11H,5H2,1-4H3,(H,21,22)/b14-9+/t10-,11+/m1/s1 |
| InChIKey | MFKKOYVPNWTFRV-RPHWRIDRSA-N |
| XLogP | 3.38 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|