C22H19BrN2O7S — CID 126259732
(2R)-2-[2-[(Z)-[3-[2-(4-bromoanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]propanoic acid (PubChem CID 126259732) has the molecular formula C22H19BrN2O7S and a molecular weight of 535.37 g/mol. Its IUPAC name is (2R)-2-[2-[(Z)-[3-[2-(4-bromoanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]propanoic acid.
| Compound Name | (2R)-2-[2-[(Z)-[3-[2-(4-bromoanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]propanoic acid |
|---|---|
| PubChem CID | 126259732 |
| Molecular Formula | C22H19BrN2O7S |
| Molecular Weight | 535.37 g/mol |
| Exact Mass | 534.01 |
| IUPAC Name | (2R)-2-[2-[(Z)-[3-[2-(4-bromoanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]propanoic acid |
| SMILES | COc1cccc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(Br)cc3)C2=O)c1O[C@H](C)C(=O)O |
| InChI | InChI=1S/C22H19BrN2O7S/c1-12(21(28)29)32-19-13(4-3-5-16(19)31-2)10-17-20(27)25(22(30)33-17)11-18(26)24-15-8-6-14(23)7-9-15/h3-10,12H,11H2,1-2H3,(H,24,26)(H,28,29)/b17-10-/t12-/m1/s1 |
| InChIKey | ZPRMSFYXGZVZBF-HJPCULJESA-N |
| XLogP | 3.98 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|