C21H18N2O8S — CID 126252382
(2S)-2-[2-methoxy-6-[(Z)-[3-[(3-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid (PubChem CID 126252382) has the molecular formula C21H18N2O8S and a molecular weight of 458.45 g/mol. Its IUPAC name is (2S)-2-[2-methoxy-6-[(Z)-[3-[(3-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid.
| Compound Name | (2S)-2-[2-methoxy-6-[(Z)-[3-[(3-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 126252382 |
| Molecular Formula | C21H18N2O8S |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | (2S)-2-[2-methoxy-6-[(Z)-[3-[(3-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid |
| SMILES | COc1cccc(/C=C2\SC(=O)N(Cc3cccc([N+](=O)[O-])c3)C2=O)c1O[C@@H](C)C(=O)O |
| InChI | InChI=1S/C21H18N2O8S/c1-12(20(25)26)31-18-14(6-4-8-16(18)30-2)10-17-19(24)22(21(27)32-17)11-13-5-3-7-15(9-13)23(28)29/h3-10,12H,11H2,1-2H3,(H,25,26)/b17-10-/t12-/m0/s1 |
| InChIKey | GJQMTQACJIHPQQ-NJPLLEPOSA-N |
| XLogP | 3.69 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|