C19H12BrIN2O7S — CID 6512513
2-[2-bromo-4-iodo-6-[(Z)-[3-[(3-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 6512513) has the molecular formula C19H12BrIN2O7S and a molecular weight of 619.19 g/mol. Its IUPAC name is 2-[2-bromo-4-iodo-6-[(Z)-[3-[(3-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-bromo-4-iodo-6-[(Z)-[3-[(3-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 6512513 |
| Molecular Formula | C19H12BrIN2O7S |
| Molecular Weight | 619.19 g/mol |
| Exact Mass | 617.86 |
| IUPAC Name | 2-[2-bromo-4-iodo-6-[(Z)-[3-[(3-nitrophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Br)cc(I)cc1/C=C1\SC(=O)N(Cc2cccc([N+](=O)[O-])c2)C1=O |
| InChI | InChI=1S/C19H12BrIN2O7S/c20-14-7-12(21)5-11(17(14)30-9-16(24)25)6-15-18(26)22(19(27)31-15)8-10-2-1-3-13(4-10)23(28)29/h1-7H,8-9H2,(H,24,25)/b15-6- |
| InChIKey | BSCTYDBKCHUARK-UUASQNMZSA-N |
| XLogP | 4.66 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.19 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|