C15H9BrN2O5S — CID 1209015
5-[(5-bromofuran-2-yl)methylidene]-3-[(3-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 1209015) has the molecular formula C15H9BrN2O5S and a molecular weight of 409.22 g/mol. Its IUPAC name is 5-[(5-bromofuran-2-yl)methylidene]-3-[(3-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[(5-bromofuran-2-yl)methylidene]-3-[(3-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1209015 |
| Molecular Formula | C15H9BrN2O5S |
| Molecular Weight | 409.22 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | 5-[(5-bromofuran-2-yl)methylidene]-3-[(3-nitrophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2ccc(Br)o2)C(=O)N1Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H9BrN2O5S/c16-13-5-4-11(23-13)7-12-14(19)17(15(20)24-12)8-9-2-1-3-10(6-9)18(21)22/h1-7H,8H2 |
| InChIKey | RNMQXYXYQCUDID-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 93.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|