C15H14NO6S- — CID 7343382
(2R)-2-[2-methoxy-6-[(E)-(3-methyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]propanoate (PubChem CID 7343382) has the molecular formula C15H14NO6S- and a molecular weight of 336.35 g/mol. Its IUPAC name is (2R)-2-[2-methoxy-6-[(E)-(3-methyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]propanoate.
| Compound Name | (2R)-2-[2-methoxy-6-[(E)-(3-methyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]propanoate |
|---|---|
| PubChem CID | 7343382 |
| Molecular Formula | C15H14NO6S- |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | (2R)-2-[2-methoxy-6-[(E)-(3-methyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]propanoate |
| SMILES | COc1cccc(/C=C2/SC(=O)N(C)C2=O)c1O[C@H](C)C(=O)[O-] |
| InChI | InChI=1S/C15H15NO6S/c1-8(14(18)19)22-12-9(5-4-6-10(12)21-3)7-11-13(17)16(2)15(20)23-11/h4-8H,1-3H3,(H,18,19)/p-1/b11-7+/t8-/m1/s1 |
| InChIKey | CHMQIQRUOKAWOI-XAPLUZPNSA-M |
| XLogP | 0.88 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|