C14H13NO5S — CID 93052871
methyl 2-[2-[(Z)-(3-methyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate (PubChem CID 93052871) has the molecular formula C14H13NO5S and a molecular weight of 307.33 g/mol. Its IUPAC name is methyl 2-[2-[(Z)-(3-methyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-[(Z)-(3-methyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 93052871 |
| Molecular Formula | C14H13NO5S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | methyl 2-[2-[(Z)-(3-methyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccccc1/C=C1\SC(=O)N(C)C1=O |
| InChI | InChI=1S/C14H13NO5S/c1-15-13(17)11(21-14(15)18)7-9-5-3-4-6-10(9)20-8-12(16)19-2/h3-7H,8H2,1-2H3/b11-7- |
| InChIKey | CFKPBZZGDKYUKM-XFFZJAGNSA-N |
| XLogP | 1.90 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|