C18H21NO5S — CID 2177958
ethyl 2-[2-[(Z)-(3-butyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate (PubChem CID 2177958) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is ethyl 2-[2-[(Z)-(3-butyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-[(Z)-(3-butyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 2177958 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | ethyl 2-[2-[(Z)-(3-butyl-2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetate |
| SMILES | CCCCN1C(=O)S/C(=C\c2ccccc2OCC(=O)OCC)C1=O |
| InChI | InChI=1S/C18H21NO5S/c1-3-5-10-19-17(21)15(25-18(19)22)11-13-8-6-7-9-14(13)24-12-16(20)23-4-2/h6-9,11H,3-5,10,12H2,1-2H3/b15-11- |
| InChIKey | JSRBMEQTAFSVAP-PTNGSMBKSA-N |
| XLogP | 3.46 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|