C20H17ClN2O4S — CID 5455942
methyl 2-[2-[(Z)-[1-(4-chlorophenyl)-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]acetate (PubChem CID 5455942) has the molecular formula C20H17ClN2O4S and a molecular weight of 416.89 g/mol. Its IUPAC name is methyl 2-[2-[(Z)-[1-(4-chlorophenyl)-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-[(Z)-[1-(4-chlorophenyl)-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 5455942 |
| Molecular Formula | C20H17ClN2O4S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | methyl 2-[2-[(Z)-[1-(4-chlorophenyl)-3-methyl-5-oxo-2-sulfanylideneimidazolidin-4-ylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccccc1/C=C1/C(=O)N(c2ccc(Cl)cc2)C(=S)N1C |
| InChI | InChI=1S/C20H17ClN2O4S/c1-22-16(11-13-5-3-4-6-17(13)27-12-18(24)26-2)19(25)23(20(22)28)15-9-7-14(21)8-10-15/h3-11H,12H2,1-2H3/b16-11- |
| InChIKey | XFYCYJHAVKHZFE-WJDWOHSUSA-N |
| XLogP | 3.50 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|