C27H20ClN3O4S — CID 5431174
methyl 2-[(5Z)-3-(4-chlorophenyl)-5-[[2-[(2-cyanophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 5431174) has the molecular formula C27H20ClN3O4S and a molecular weight of 517.99 g/mol. Its IUPAC name is methyl 2-[(5Z)-3-(4-chlorophenyl)-5-[[2-[(2-cyanophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[(5Z)-3-(4-chlorophenyl)-5-[[2-[(2-cyanophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 5431174 |
| Molecular Formula | C27H20ClN3O4S |
| Molecular Weight | 517.99 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | methyl 2-[(5Z)-3-(4-chlorophenyl)-5-[[2-[(2-cyanophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=S)N(c2ccc(Cl)cc2)C(=O)/C1=C/c1ccccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C27H20ClN3O4S/c1-34-25(32)16-30-23(26(33)31(27(30)36)22-12-10-21(28)11-13-22)14-18-6-4-5-9-24(18)35-17-20-8-3-2-7-19(20)15-29/h2-14H,16-17H2,1H3/b23-14- |
| InChIKey | PFHKXNPCTUXDLU-UCQKPKSFSA-N |
| XLogP | 4.94 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.99 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|