C29H28N2O4S — CID 126064826
methyl 2-[(5Z)-3-(4-ethylphenyl)-5-[[2-[(3-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 126064826) has the molecular formula C29H28N2O4S and a molecular weight of 500.62 g/mol. Its IUPAC name is methyl 2-[(5Z)-3-(4-ethylphenyl)-5-[[2-[(3-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[(5Z)-3-(4-ethylphenyl)-5-[[2-[(3-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 126064826 |
| Molecular Formula | C29H28N2O4S |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | methyl 2-[(5Z)-3-(4-ethylphenyl)-5-[[2-[(3-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | CCc1ccc(N2C(=O)/C(=C/c3ccccc3OCc3cccc(C)c3)N(CC(=O)OC)C2=S)cc1 |
| InChI | InChI=1S/C29H28N2O4S/c1-4-21-12-14-24(15-13-21)31-28(33)25(30(29(31)36)18-27(32)34-3)17-23-10-5-6-11-26(23)35-19-22-9-7-8-20(2)16-22/h5-17H,4,18-19H2,1-3H3/b25-17- |
| InChIKey | XUMRHJLCYKLADF-UQQQWYQISA-N |
| XLogP | 5.28 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|