C23H23IN2O5S — CID 126064969
methyl 2-[(5Z)-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 126064969) has the molecular formula C23H23IN2O5S and a molecular weight of 566.42 g/mol. Its IUPAC name is methyl 2-[(5Z)-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[(5Z)-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 126064969 |
| Molecular Formula | C23H23IN2O5S |
| Molecular Weight | 566.42 g/mol |
| Exact Mass | 566.04 |
| IUPAC Name | methyl 2-[(5Z)-5-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylidene]-3-(4-ethylphenyl)-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | CCOc1cc(/C=C2/C(=O)N(c3ccc(CC)cc3)C(=S)N2CC(=O)OC)cc(I)c1O |
| InChI | InChI=1S/C23H23IN2O5S/c1-4-14-6-8-16(9-7-14)26-22(29)18(25(23(26)32)13-20(27)30-3)11-15-10-17(24)21(28)19(12-15)31-5-2/h6-12,28H,4-5,13H2,1-3H3/b18-11- |
| InChIKey | SRMABFUJFAWHHZ-WQRHYEAKSA-N |
| XLogP | 4.11 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|