C28H23ClFIN2O5S — CID 126082094
methyl 2-[(5Z)-3-(4-chlorophenyl)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate (PubChem CID 126082094) has the molecular formula C28H23ClFIN2O5S and a molecular weight of 680.92 g/mol. Its IUPAC name is methyl 2-[(5Z)-3-(4-chlorophenyl)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[(5Z)-3-(4-chlorophenyl)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 126082094 |
| Molecular Formula | C28H23ClFIN2O5S |
| Molecular Weight | 680.92 g/mol |
| Exact Mass | 680.00 |
| IUPAC Name | methyl 2-[(5Z)-3-(4-chlorophenyl)-5-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-4-oxo-2-sulfanylideneimidazolidin-1-yl]acetate |
| SMILES | CCOc1cc(/C=C2/C(=O)N(c3ccc(Cl)cc3)C(=S)N2CC(=O)OC)cc(I)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C28H23ClFIN2O5S/c1-3-37-24-14-18(12-22(31)26(24)38-16-17-4-8-20(30)9-5-17)13-23-27(35)33(21-10-6-19(29)7-11-21)28(39)32(23)15-25(34)36-2/h4-14H,3,15-16H2,1-2H3/b23-13- |
| InChIKey | ZRJIHWFHIOGJCB-QRVIBDJDSA-N |
| XLogP | 6.21 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.92 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|